C23H31Cl3N2Si — CID 139111488
1-tert-butyl-2,2,2-trichloro-3-[2,6-di(propan-2-yl)phenyl]-4-phenyl-3-aza-1-azonia-2-silanuidacyclobut-4-ene (PubChem CID 139111488) has the molecular formula C23H31Cl3N2Si and a molecular weight of 469.96 g/mol. Its IUPAC name is 1-tert-butyl-2,2,2-trichloro-3-[2,6-di(propan-2-yl)phenyl]-4-phenyl-3-aza-1-azonia-2-silanuidacyclobut-4-ene.
| Compound Name | 1-tert-butyl-2,2,2-trichloro-3-[2,6-di(propan-2-yl)phenyl]-4-phenyl-3-aza-1-azonia-2-silanuidacyclobut-4-ene |
|---|---|
| PubChem CID | 139111488 |
| Molecular Formula | C23H31Cl3N2Si |
| Molecular Weight | 469.96 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | 1-tert-butyl-2,2,2-trichloro-3-[2,6-di(propan-2-yl)phenyl]-4-phenyl-3-aza-1-azonia-2-silanuidacyclobut-4-ene |
| SMILES | CC(C)c1cccc(C(C)C)c1N1C(c2ccccc2)=[N+](C(C)(C)C)[Si-]1(Cl)(Cl)Cl |
| InChI | InChI=1S/C23H31Cl3N2Si/c1-16(2)19-14-11-15-20(17(3)4)21(19)27-22(18-12-9-8-10-13-18)28(23(5,6)7)29(27,24,25)26/h8-17H,1-7H3 |
| InChIKey | XSZHRUIVBCMVGG-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.96 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|