C34H42N4 — CID 171599917
3,5-bis[2,6-di(propan-2-yl)phenyl]-1,7-dimethyl-2,6-dihydroimidazo[4,5-f]benzimidazole-1,7-diium-2,6-diide (PubChem CID 171599917) has the molecular formula C34H42N4 and a molecular weight of 506.74 g/mol. Its IUPAC name is 3,5-bis[2,6-di(propan-2-yl)phenyl]-1,7-dimethyl-2,6-dihydroimidazo[4,5-f]benzimidazole-1,7-diium-2,6-diide.
| Compound Name | 3,5-bis[2,6-di(propan-2-yl)phenyl]-1,7-dimethyl-2,6-dihydroimidazo[4,5-f]benzimidazole-1,7-diium-2,6-diide |
|---|---|
| PubChem CID | 171599917 |
| Molecular Formula | C34H42N4 |
| Molecular Weight | 506.74 g/mol |
| Exact Mass | 506.34 |
| IUPAC Name | 3,5-bis[2,6-di(propan-2-yl)phenyl]-1,7-dimethyl-2,6-dihydroimidazo[4,5-f]benzimidazole-1,7-diium-2,6-diide |
| SMILES | CC(C)c1cccc(C(C)C)c1-n1[c-][n+](C)c2cc3c(cc21)n(-c1c(C(C)C)cccc1C(C)C)[c-][n+]3C |
| InChI | InChI=1S/C34H42N4/c1-21(2)25-13-11-14-26(22(3)4)33(25)37-19-35(9)29-17-30-32(18-31(29)37)38(20-36(30)10)34-27(23(5)6)15-12-16-28(34)24(7)8/h11-18,21-24H,1-10H3 |
| InChIKey | VVDJKWBYDHKTPY-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 17.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.74 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|