C18H22O — CID 163541275
4-buta-1,3-dien-2-yl-2-ethyl-3,7-dimethyl-4a,5-dihydronaphthalen-1-ol (PubChem CID 163541275) has the molecular formula C18H22O and a molecular weight of 254.37 g/mol. Its IUPAC name is 4-buta-1,3-dien-2-yl-2-ethyl-3,7-dimethyl-4a,5-dihydronaphthalen-1-ol.
| Compound Name | 4-buta-1,3-dien-2-yl-2-ethyl-3,7-dimethyl-4a,5-dihydronaphthalen-1-ol |
|---|---|
| PubChem CID | 163541275 |
| Molecular Formula | C18H22O |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | 4-buta-1,3-dien-2-yl-2-ethyl-3,7-dimethyl-4a,5-dihydronaphthalen-1-ol |
| SMILES | C=CC(=C)C1=C(C)C(CC)=C(O)C2=CC(C)=CCC21 |
| InChI | InChI=1S/C18H22O/c1-6-12(4)17-13(5)14(7-2)18(19)16-10-11(3)8-9-15(16)17/h6,8,10,15,19H,1,4,7,9H2,2-3,5H3 |
| InChIKey | FBHAKBPJSBUJRY-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|