C15H22 — CID 145324638
4-ethyl-2-methyl-1-(4-methylpenta-1,3-dien-2-yl)cyclohexa-1,3-diene (PubChem CID 145324638) has the molecular formula C15H22 and a molecular weight of 202.34 g/mol. Its IUPAC name is 4-ethyl-2-methyl-1-(4-methylpenta-1,3-dien-2-yl)cyclohexa-1,3-diene.
| Compound Name | 4-ethyl-2-methyl-1-(4-methylpenta-1,3-dien-2-yl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 145324638 |
| Molecular Formula | C15H22 |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | 4-ethyl-2-methyl-1-(4-methylpenta-1,3-dien-2-yl)cyclohexa-1,3-diene |
| SMILES | C=C(C=C(C)C)C1=C(C)C=C(CC)CC1 |
| InChI | InChI=1S/C15H22/c1-6-14-7-8-15(13(5)10-14)12(4)9-11(2)3/h9-10H,4,6-8H2,1-3,5H3 |
| InChIKey | ROBSHJPNLOPKFT-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|