About (2-oxidooxazinan-4-yl) acetate
(2-oxidooxazinan-4-yl) acetate (PubChem CID 163541996) has the molecular formula C6H10NO4-
and a molecular weight of 160.15 g/mol. Its IUPAC name is (2-oxidooxazinan-4-yl) acetate.
Molecular Properties
| Compound Name | (2-oxidooxazinan-4-yl) acetate |
| PubChem CID | 163541996 |
| Molecular Formula | C6H10NO4- |
| Molecular Weight | 160.15 g/mol |
| Exact Mass | 160.06 |
| IUPAC Name | (2-oxidooxazinan-4-yl) acetate |
| SMILES | CC(=O)OC1CCON([O-])C1 |
| InChI | InChI=1S/C6H10NO4/c1-5(8)11-6-2-3-10-7(9)4-6/h6H,2-4H2,1H3/q-1 |
| InChIKey | OKVHRTRNJKSCIM-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.15 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2-oxidooxazinan-4-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxidooxazinan-4-yl) acetate?
The IUPAC name of (2-oxidooxazinan-4-yl) acetate (CID 163541996) is (2-oxidooxazinan-4-yl) acetate.
What is the SMILES notation for (2-oxidooxazinan-4-yl) acetate?
The canonical SMILES for (2-oxidooxazinan-4-yl) acetate is CC(=O)OC1CCON([O-])C1.
What is the InChIKey of (2-oxidooxazinan-4-yl) acetate?
The InChIKey is OKVHRTRNJKSCIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10NO4/c1-5(8)11-6-2-3-10-7(9)4-6/h6H,2-4H2,1H3/q-1.
What are the key properties of (2-oxidooxazinan-4-yl) acetate?
(2-oxidooxazinan-4-yl) acetate has a molecular weight of 160.15 g/mol, XLogP of 0.05, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxidooxazinan-4-yl) acetate is sourced from PubChem (CID 163541996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).