C8H15NO3 — CID 163543432
(2S)-2-acetamido-2,4,5,5,5-pentadeuterio-4-methylpentanoic acid (PubChem CID 163543432) has the molecular formula C8H15NO3 and a molecular weight of 178.24 g/mol. Its IUPAC name is (2S)-2-acetamido-2,4,5,5,5-pentadeuterio-4-methylpentanoic acid.
| Compound Name | (2S)-2-acetamido-2,4,5,5,5-pentadeuterio-4-methylpentanoic acid |
|---|---|
| PubChem CID | 163543432 |
| Molecular Formula | C8H15NO3 |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | (2S)-2-acetamido-2,4,5,5,5-pentadeuterio-4-methylpentanoic acid |
| SMILES | [2H]C([2H])([2H])C([2H])(C)C[C@]([2H])(NC(C)=O)C(=O)O |
| InChI | InChI=1S/C8H15NO3/c1-5(2)4-7(8(11)12)9-6(3)10/h5,7H,4H2,1-3H3,(H,9,10)(H,11,12)/t7-/m0/s1/i1D3,5D,7D/t5?,7- |
| InChIKey | WXNXCEHXYPACJF-XDDIFYASSA-N |
| XLogP | 0.62 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |