C9H12Cl3NO — CID 163543876
O-[3-(3,4-dichlorophenyl)propyl]hydroxylamine;hydrochloride (PubChem CID 163543876) has the molecular formula C9H12Cl3NO and a molecular weight of 256.56 g/mol. Its IUPAC name is O-[3-(3,4-dichlorophenyl)propyl]hydroxylamine;hydrochloride.
| Compound Name | O-[3-(3,4-dichlorophenyl)propyl]hydroxylamine;hydrochloride |
|---|---|
| PubChem CID | 163543876 |
| Molecular Formula | C9H12Cl3NO |
| Molecular Weight | 256.56 g/mol |
| Exact Mass | 255.00 |
| IUPAC Name | O-[3-(3,4-dichlorophenyl)propyl]hydroxylamine;hydrochloride |
| SMILES | Cl.NOCCCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C9H11Cl2NO.ClH/c10-8-4-3-7(6-9(8)11)2-1-5-13-12;/h3-4,6H,1-2,5,12H2;1H |
| InChIKey | FDJCLBVVNQEPSG-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.56 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|