C20H40O3SSi — CID 163544853
[dimethyl-[2-(2-methyloxan-4-yl)ethyl]-λ4-sulfanyl]oxy-dimethyl-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silane (PubChem CID 163544853) has the molecular formula C20H40O3SSi and a molecular weight of 388.69 g/mol. Its IUPAC name is [dimethyl-[2-(2-methyloxan-4-yl)ethyl]-λ4-sulfanyl]oxy-dimethyl-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silane.
| Compound Name | [dimethyl-[2-(2-methyloxan-4-yl)ethyl]-λ4-sulfanyl]oxy-dimethyl-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silane |
|---|---|
| PubChem CID | 163544853 |
| Molecular Formula | C20H40O3SSi |
| Molecular Weight | 388.69 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | [dimethyl-[2-(2-methyloxan-4-yl)ethyl]-λ4-sulfanyl]oxy-dimethyl-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silane |
| SMILES | CC1CC(CCS(C)(C)O[Si](C)(C)CCC2CCC3OC3C2)CCO1 |
| InChI | InChI=1S/C20H40O3SSi/c1-16-14-18(8-11-21-16)9-12-24(2,3)23-25(4,5)13-10-17-6-7-19-20(15-17)22-19/h16-20H,6-15H2,1-5H3 |
| InChIKey | FEEAKBKYWJLHRI-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.69 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|