C16H32O2Si2 — CID 123428116
cyclohexylsilyloxy-dimethyl-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silane (PubChem CID 123428116) has the molecular formula C16H32O2Si2 and a molecular weight of 312.60 g/mol. Its IUPAC name is cyclohexylsilyloxy-dimethyl-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silane.
| Compound Name | cyclohexylsilyloxy-dimethyl-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silane |
|---|---|
| PubChem CID | 123428116 |
| Molecular Formula | C16H32O2Si2 |
| Molecular Weight | 312.60 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | cyclohexylsilyloxy-dimethyl-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silane |
| SMILES | C[Si](C)(CCC1CCC2OC2C1)O[SiH2]C1CCCCC1 |
| InChI | InChI=1S/C16H32O2Si2/c1-20(2,18-19-14-6-4-3-5-7-14)11-10-13-8-9-15-16(12-13)17-15/h13-16H,3-12,19H2,1-2H3 |
| InChIKey | ZNTDFVRFRIXYTN-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.60 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|