C24H27N3O6 — CID 163548560
tert-butyl N-[4-[2-(1,3-benzodioxol-5-yloxy)pyridine-3-carbonyl]iminocyclohexyl]carbamate (PubChem CID 163548560) has the molecular formula C24H27N3O6 and a molecular weight of 453.50 g/mol. Its IUPAC name is tert-butyl N-[4-[2-(1,3-benzodioxol-5-yloxy)pyridine-3-carbonyl]iminocyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[2-(1,3-benzodioxol-5-yloxy)pyridine-3-carbonyl]iminocyclohexyl]carbamate |
|---|---|
| PubChem CID | 163548560 |
| Molecular Formula | C24H27N3O6 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | tert-butyl N-[4-[2-(1,3-benzodioxol-5-yloxy)pyridine-3-carbonyl]iminocyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCC(=NC(=O)c2cccnc2Oc2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C24H27N3O6/c1-24(2,3)33-23(29)27-16-8-6-15(7-9-16)26-21(28)18-5-4-12-25-22(18)32-17-10-11-19-20(13-17)31-14-30-19/h4-5,10-13,16H,6-9,14H2,1-3H3,(H,27,29)/b26-15- |
| InChIKey | FHCINDXXABDNCO-YSMPRRRNSA-N |
| XLogP | 4.65 |
| TPSA | 108.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|