C26H36N2O6 — CID 163550247
benzyl 1-[2-[(4S)-4-hydroxy-2,5-dimethyl-3-oxohexanoyl]imino-4-methylpentanoyl]pyrrolidine-2-carboxylate (PubChem CID 163550247) has the molecular formula C26H36N2O6 and a molecular weight of 472.58 g/mol. Its IUPAC name is benzyl 1-[2-[(4S)-4-hydroxy-2,5-dimethyl-3-oxohexanoyl]imino-4-methylpentanoyl]pyrrolidine-2-carboxylate.
| Compound Name | benzyl 1-[2-[(4S)-4-hydroxy-2,5-dimethyl-3-oxohexanoyl]imino-4-methylpentanoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 163550247 |
| Molecular Formula | C26H36N2O6 |
| Molecular Weight | 472.58 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | benzyl 1-[2-[(4S)-4-hydroxy-2,5-dimethyl-3-oxohexanoyl]imino-4-methylpentanoyl]pyrrolidine-2-carboxylate |
| SMILES | CC(C)C/C(=N/C(=O)C(C)C(=O)[C@@H](O)C(C)C)C(=O)N1CCCC1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H36N2O6/c1-16(2)14-20(27-24(31)18(5)23(30)22(29)17(3)4)25(32)28-13-9-12-21(28)26(33)34-15-19-10-7-6-8-11-19/h6-8,10-11,16-18,21-22,29H,9,12-15H2,1-5H3/b27-20-/t18?,21?,22-/m0/s1 |
| InChIKey | FILOHKNLOOVUPL-QWZCBMNNSA-N |
| XLogP | 2.96 |
| TPSA | 113.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.58 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|