C6H9NO7 — CID 163550929
(3R,4S,5S,6S)-3,4-dihydroxy-6-(hydroxymethyl)-5-nitrooxan-2-one (PubChem CID 163550929) has the molecular formula C6H9NO7 and a molecular weight of 207.14 g/mol. Its IUPAC name is (3R,4S,5S,6S)-3,4-dihydroxy-6-(hydroxymethyl)-5-nitrooxan-2-one.
| Compound Name | (3R,4S,5S,6S)-3,4-dihydroxy-6-(hydroxymethyl)-5-nitrooxan-2-one |
|---|---|
| PubChem CID | 163550929 |
| Molecular Formula | C6H9NO7 |
| Molecular Weight | 207.14 g/mol |
| Exact Mass | 207.04 |
| IUPAC Name | (3R,4S,5S,6S)-3,4-dihydroxy-6-(hydroxymethyl)-5-nitrooxan-2-one |
| SMILES | O=C1O[C@H](CO)[C@@H]([N+](=O)[O-])[C@H](O)[C@H]1O |
| InChI | InChI=1S/C6H9NO7/c8-1-2-3(7(12)13)4(9)5(10)6(11)14-2/h2-5,8-10H,1H2/t2-,3-,4+,5-/m1/s1 |
| InChIKey | FIZULDOCCIBYRZ-SQOUGZDYSA-N |
| XLogP | -2.73 |
| TPSA | 130.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.14 |
| LogP ≤ 5 | -2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|