C37H38ClNSi — CID 163551090
[4-[4-[3-(1-adamantyl)-6-chlorocarbazol-9-yl]phenyl]phenyl]-trimethylsilane (PubChem CID 163551090) has the molecular formula C37H38ClNSi and a molecular weight of 560.26 g/mol. Its IUPAC name is [4-[4-[3-(1-adamantyl)-6-chlorocarbazol-9-yl]phenyl]phenyl]-trimethylsilane.
| Compound Name | [4-[4-[3-(1-adamantyl)-6-chlorocarbazol-9-yl]phenyl]phenyl]-trimethylsilane |
|---|---|
| PubChem CID | 163551090 |
| Molecular Formula | C37H38ClNSi |
| Molecular Weight | 560.26 g/mol |
| Exact Mass | 559.25 |
| IUPAC Name | [4-[4-[3-(1-adamantyl)-6-chlorocarbazol-9-yl]phenyl]phenyl]-trimethylsilane |
| SMILES | C[Si](C)(C)c1ccc(-c2ccc(-n3c4ccc(Cl)cc4c4cc(C56CC7CC(CC(C7)C5)C6)ccc43)cc2)cc1 |
| InChI | InChI=1S/C37H38ClNSi/c1-40(2,3)32-12-6-28(7-13-32)27-4-10-31(11-5-27)39-35-14-8-29(19-33(35)34-20-30(38)9-15-36(34)39)37-21-24-16-25(22-37)18-26(17-24)23-37/h4-15,19-20,24-26H,16-18,21-23H2,1-3H3 |
| InChIKey | FJDFCIDSJJOTKN-UHFFFAOYSA-N |
| XLogP | 10.12 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.26 |
| LogP ≤ 5 | 10.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|