C28H32 — CID 163553569
9-(6-ethyl-7-propan-2-ylcyclohepta-1,4,6-trien-1-yl)-9-[(E)-prop-1-enyl]-1,9a-dihydrofluorene (PubChem CID 163553569) has the molecular formula C28H32 and a molecular weight of 368.56 g/mol. Its IUPAC name is 9-(6-ethyl-7-propan-2-ylcyclohepta-1,4,6-trien-1-yl)-9-[(E)-prop-1-enyl]-1,9a-dihydrofluorene.
| Compound Name | 9-(6-ethyl-7-propan-2-ylcyclohepta-1,4,6-trien-1-yl)-9-[(E)-prop-1-enyl]-1,9a-dihydrofluorene |
|---|---|
| PubChem CID | 163553569 |
| Molecular Formula | C28H32 |
| Molecular Weight | 368.56 g/mol |
| Exact Mass | 368.25 |
| IUPAC Name | 9-(6-ethyl-7-propan-2-ylcyclohepta-1,4,6-trien-1-yl)-9-[(E)-prop-1-enyl]-1,9a-dihydrofluorene |
| SMILES | C/C=C/C1(C2=CCC=CC(CC)=C2C(C)C)c2ccccc2C2=CC=CCC21 |
| InChI | InChI=1S/C28H32/c1-5-19-28(26-18-10-7-13-21(6-2)27(26)20(3)4)24-16-11-8-14-22(24)23-15-9-12-17-25(23)28/h5,7-9,11-16,18-20,25H,6,10,17H2,1-4H3/b19-5+ |
| InChIKey | FLDLLYQMXLBILX-PTXOJBNSSA-N |
| XLogP | 7.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.56 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|