9-(cyanomethyl)-1,9a-dihydrofluorene-9-carboxylic acid

C16H13NO2 — CID 154528066

IUPAC9-(cyanomethyl)-1,9a-dihydrofluorene-9-carboxylic acid
SMILESN#CCC1(C(=O)O)c2ccccc2C2=CC=CCC21
InChIInChI=1S/C16H13NO2/c17-10-9-16(15(18)19)13-7-3-1-5-11(13)12-6-2-4-8-14(12)16/h1-7,14H,8-9H2,(H,18,19)
InChIKeyMAKYNIFSOOFCKO-UHFFFAOYSA-N
MW251.28 g/mol
LogP2.90
Rot. Bonds2

About 9-(cyanomethyl)-1,9a-dihydrofluorene-9-carboxylic acid

9-(cyanomethyl)-1,9a-dihydrofluorene-9-carboxylic acid (PubChem CID 154528066) has the molecular formula C16H13NO2 and a molecular weight of 251.28 g/mol. Its IUPAC name is 9-(cyanomethyl)-1,9a-dihydrofluorene-9-carboxylic acid.

Molecular Properties

Compound Name9-(cyanomethyl)-1,9a-dihydrofluorene-9-carboxylic acid
PubChem CID154528066
Molecular FormulaC16H13NO2
Molecular Weight251.28 g/mol
Exact Mass251.09
IUPAC Name9-(cyanomethyl)-1,9a-dihydrofluorene-9-carboxylic acid
SMILESN#CCC1(C(=O)O)c2ccccc2C2=CC=CCC21
InChIInChI=1S/C16H13NO2/c17-10-9-16(15(18)19)13-7-3-1-5-11(13)12-6-2-4-8-14(12)16/h1-7,14H,8-9H2,(H,18,19)
InChIKeyMAKYNIFSOOFCKO-UHFFFAOYSA-N
XLogP2.90
TPSA61.09 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500251.28
LogP ≤ 52.90
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 9-(cyanomethyl)-1,9a-dihydrofluorene-9-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 9-(cyanomethyl)-1,9a-dihydrofluorene-9-carboxylic acid?
The IUPAC name of 9-(cyanomethyl)-1,9a-dihydrofluorene-9-carboxylic acid (CID 154528066) is 9-(cyanomethyl)-1,9a-dihydrofluorene-9-carboxylic acid.
What is the SMILES notation for 9-(cyanomethyl)-1,9a-dihydrofluorene-9-carboxylic acid?
The canonical SMILES for 9-(cyanomethyl)-1,9a-dihydrofluorene-9-carboxylic acid is N#CCC1(C(=O)O)c2ccccc2C2=CC=CCC21.
What is the InChIKey of 9-(cyanomethyl)-1,9a-dihydrofluorene-9-carboxylic acid?
The InChIKey is MAKYNIFSOOFCKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13NO2/c17-10-9-16(15(18)19)13-7-3-1-5-11(13)12-6-2-4-8-14(12)16/h1-7,14H,8-9H2,(H,18,19).
What are the key properties of 9-(cyanomethyl)-1,9a-dihydrofluorene-9-carboxylic acid?
9-(cyanomethyl)-1,9a-dihydrofluorene-9-carboxylic acid has a molecular weight of 251.28 g/mol, XLogP of 2.90, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(cyanomethyl)-1,9a-dihydrofluorene-9-carboxylic acid is sourced from PubChem (CID 154528066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).