C16H13NO2 — CID 154528066
9-(cyanomethyl)-1,9a-dihydrofluorene-9-carboxylic acid (PubChem CID 154528066) has the molecular formula C16H13NO2 and a molecular weight of 251.28 g/mol. Its IUPAC name is 9-(cyanomethyl)-1,9a-dihydrofluorene-9-carboxylic acid.
| Compound Name | 9-(cyanomethyl)-1,9a-dihydrofluorene-9-carboxylic acid |
|---|---|
| PubChem CID | 154528066 |
| Molecular Formula | C16H13NO2 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 9-(cyanomethyl)-1,9a-dihydrofluorene-9-carboxylic acid |
| SMILES | N#CCC1(C(=O)O)c2ccccc2C2=CC=CCC21 |
| InChI | InChI=1S/C16H13NO2/c17-10-9-16(15(18)19)13-7-3-1-5-11(13)12-6-2-4-8-14(12)16/h1-7,14H,8-9H2,(H,18,19) |
| InChIKey | MAKYNIFSOOFCKO-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |