C31H35FN6O7 — CID 163556782
4-O-butyl 1-O-methyl 2-[(R)-[[2-[3-(4-carbamimidoylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetyl]amino]-[(3-fluoro-1H-indole-2-carbonyl)amino]methyl]butanedioate (PubChem CID 163556782) has the molecular formula C31H35FN6O7 and a molecular weight of 622.65 g/mol. Its IUPAC name is 4-O-butyl 1-O-methyl 2-[(R)-[[2-[3-(4-carbamimidoylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetyl]amino]-[(3-fluoro-1H-indole-2-carbonyl)amino]methyl]butanedioate.
| Compound Name | 4-O-butyl 1-O-methyl 2-[(R)-[[2-[3-(4-carbamimidoylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetyl]amino]-[(3-fluoro-1H-indole-2-carbonyl)amino]methyl]butanedioate |
|---|---|
| PubChem CID | 163556782 |
| Molecular Formula | C31H35FN6O7 |
| Molecular Weight | 622.65 g/mol |
| Exact Mass | 622.26 |
| IUPAC Name | 4-O-butyl 1-O-methyl 2-[(R)-[[2-[3-(4-carbamimidoylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetyl]amino]-[(3-fluoro-1H-indole-2-carbonyl)amino]methyl]butanedioate |
| SMILES | [H]/N=C(\N)c1ccc(C2=NOC(CC(=O)N[C@H](NC(=O)c3[nH]c4ccccc4c3F)C(CC(=O)OCCCC)C(=O)OC)C2)cc1 |
| InChI | InChI=1S/C31H35FN6O7/c1-3-4-13-44-25(40)16-21(31(42)43-2)29(37-30(41)27-26(32)20-7-5-6-8-22(20)35-27)36-24(39)15-19-14-23(38-45-19)17-9-11-18(12-10-17)28(33)34/h5-12,19,21,29,35H,3-4,13-16H2,1-2H3,(H3,33,34)(H,36,39)(H,37,41)/t19?,21?,29-/m1/s1 |
| InChIKey | FUWKBPGFJANLKH-VOLFVVBRSA-N |
| XLogP | 2.87 |
| TPSA | 198.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.65 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|