C31H33N3O2 — CID 163557004
(1R,9R,10S)-5-benzyl-10-methyl-11-oxo-4-(2-phenylmethoxyethyl)-3,5-diazatricyclo[7.6.0.02,6]pentadeca-2(6),3,12-triene-12-carbonitrile (PubChem CID 163557004) has the molecular formula C31H33N3O2 and a molecular weight of 479.62 g/mol. Its IUPAC name is (1R,9R,10S)-5-benzyl-10-methyl-11-oxo-4-(2-phenylmethoxyethyl)-3,5-diazatricyclo[7.6.0.02,6]pentadeca-2(6),3,12-triene-12-carbonitrile.
| Compound Name | (1R,9R,10S)-5-benzyl-10-methyl-11-oxo-4-(2-phenylmethoxyethyl)-3,5-diazatricyclo[7.6.0.02,6]pentadeca-2(6),3,12-triene-12-carbonitrile |
|---|---|
| PubChem CID | 163557004 |
| Molecular Formula | C31H33N3O2 |
| Molecular Weight | 479.62 g/mol |
| Exact Mass | 479.26 |
| IUPAC Name | (1R,9R,10S)-5-benzyl-10-methyl-11-oxo-4-(2-phenylmethoxyethyl)-3,5-diazatricyclo[7.6.0.02,6]pentadeca-2(6),3,12-triene-12-carbonitrile |
| SMILES | C[C@@H]1C(=O)C(C#N)=CCC[C@H]2c3nc(CCOCc4ccccc4)n(Cc4ccccc4)c3CC[C@@H]12 |
| InChI | InChI=1S/C31H33N3O2/c1-22-26-15-16-28-30(27(26)14-8-13-25(19-32)31(22)35)33-29(34(28)20-23-9-4-2-5-10-23)17-18-36-21-24-11-6-3-7-12-24/h2-7,9-13,22,26-27H,8,14-18,20-21H2,1H3/t22-,26-,27+/m0/s1 |
| InChIKey | FNXSTDTYCQYDNA-WDDWZANVSA-N |
| XLogP | 5.79 |
| TPSA | 67.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.62 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|