C22H27N3O5 — CID 163558984
[4-[4-(3-carbamoyloxy-3-cyclohexa-1,5-dien-1-ylpropanoyl)piperazin-1-yl]phenyl] acetate (PubChem CID 163558984) has the molecular formula C22H27N3O5 and a molecular weight of 413.47 g/mol. Its IUPAC name is [4-[4-(3-carbamoyloxy-3-cyclohexa-1,5-dien-1-ylpropanoyl)piperazin-1-yl]phenyl] acetate.
| Compound Name | [4-[4-(3-carbamoyloxy-3-cyclohexa-1,5-dien-1-ylpropanoyl)piperazin-1-yl]phenyl] acetate |
|---|---|
| PubChem CID | 163558984 |
| Molecular Formula | C22H27N3O5 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | [4-[4-(3-carbamoyloxy-3-cyclohexa-1,5-dien-1-ylpropanoyl)piperazin-1-yl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(N2CCN(C(=O)CC(OC(N)=O)C3=CCCC=C3)CC2)cc1 |
| InChI | InChI=1S/C22H27N3O5/c1-16(26)29-19-9-7-18(8-10-19)24-11-13-25(14-12-24)21(27)15-20(30-22(23)28)17-5-3-2-4-6-17/h3,5-10,20H,2,4,11-15H2,1H3,(H2,23,28) |
| InChIKey | FPODFFZGIVBNEV-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 102.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|