C12H17NO5 — CID 163565652
3-[5-(deuteriooxymethyl)-4-hydroxyoxolan-2-yl]-1,5-dimethyl-3H-pyridine-2,6-dione (PubChem CID 163565652) has the molecular formula C12H17NO5 and a molecular weight of 256.28 g/mol. Its IUPAC name is 3-[5-(deuteriooxymethyl)-4-hydroxyoxolan-2-yl]-1,5-dimethyl-3H-pyridine-2,6-dione.
| Compound Name | 3-[5-(deuteriooxymethyl)-4-hydroxyoxolan-2-yl]-1,5-dimethyl-3H-pyridine-2,6-dione |
|---|---|
| PubChem CID | 163565652 |
| Molecular Formula | C12H17NO5 |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 3-[5-(deuteriooxymethyl)-4-hydroxyoxolan-2-yl]-1,5-dimethyl-3H-pyridine-2,6-dione |
| SMILES | [2H]OCC1OC(C2C=C(C)C(=O)N(C)C2=O)CC1O |
| InChI | InChI=1S/C12H17NO5/c1-6-3-7(12(17)13(2)11(6)16)9-4-8(15)10(5-14)18-9/h3,7-10,14-15H,4-5H2,1-2H3/i14D |
| InChIKey | AJGMGODBEXTETO-FCFVPJCTSA-N |
| XLogP | -0.94 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|