C18H27IN2O4S2 — CID 163575361
2-iodopropane;3-methyl-2-(3-methyl-1,2-thiazol-5-yl)butanoic acid;2-(3-methyl-1,2-thiazol-5-yl)acetic acid (PubChem CID 163575361) has the molecular formula C18H27IN2O4S2 and a molecular weight of 526.46 g/mol. Its IUPAC name is 2-iodopropane;3-methyl-2-(3-methyl-1,2-thiazol-5-yl)butanoic acid;2-(3-methyl-1,2-thiazol-5-yl)acetic acid.
| Compound Name | 2-iodopropane;3-methyl-2-(3-methyl-1,2-thiazol-5-yl)butanoic acid;2-(3-methyl-1,2-thiazol-5-yl)acetic acid |
|---|---|
| PubChem CID | 163575361 |
| Molecular Formula | C18H27IN2O4S2 |
| Molecular Weight | 526.46 g/mol |
| Exact Mass | 526.05 |
| IUPAC Name | 2-iodopropane;3-methyl-2-(3-methyl-1,2-thiazol-5-yl)butanoic acid;2-(3-methyl-1,2-thiazol-5-yl)acetic acid |
| SMILES | CC(C)I.Cc1cc(C(C(=O)O)C(C)C)sn1.Cc1cc(CC(=O)O)sn1 |
| InChI | InChI=1S/C9H13NO2S.C6H7NO2S.C3H7I/c1-5(2)8(9(11)12)7-4-6(3)10-13-7;1-4-2-5(10-7-4)3-6(8)9;1-3(2)4/h4-5,8H,1-3H3,(H,11,12);2H,3H2,1H3,(H,8,9);3H,1-2H3 |
| InChIKey | GCZDNWJPPZUNAH-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 100.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.46 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|