C9H13NO2S — CID 82372990
2-[3-(2-methylpropyl)-1,2-thiazol-5-yl]acetic acid (PubChem CID 82372990) has the molecular formula C9H13NO2S and a molecular weight of 199.27 g/mol. Its IUPAC name is 2-[3-(2-methylpropyl)-1,2-thiazol-5-yl]acetic acid.
| Compound Name | 2-[3-(2-methylpropyl)-1,2-thiazol-5-yl]acetic acid |
|---|---|
| PubChem CID | 82372990 |
| Molecular Formula | C9H13NO2S |
| Molecular Weight | 199.27 g/mol |
| Exact Mass | 199.07 |
| IUPAC Name | 2-[3-(2-methylpropyl)-1,2-thiazol-5-yl]acetic acid |
| SMILES | CC(C)Cc1cc(CC(=O)O)sn1 |
| InChI | InChI=1S/C9H13NO2S/c1-6(2)3-7-4-8(13-10-7)5-9(11)12/h4,6H,3,5H2,1-2H3,(H,11,12) |
| InChIKey | QCSADEKXHLTWIG-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.27 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |