2-(3-propan-2-yl-1,2-thiazol-5-yl)propanoic acid

C9H13NO2S — CID 82397722

IUPAC2-(3-propan-2-yl-1,2-thiazol-5-yl)propanoic acid
SMILESCC(C)c1cc(C(C)C(=O)O)sn1
InChIInChI=1S/C9H13NO2S/c1-5(2)7-4-8(13-10-7)6(3)9(11)12/h4-6H,1-3H3,(H,11,12)
InChIKeyQQKIIEKUOUZJCD-UHFFFAOYSA-N
MW199.27 g/mol
LogP2.45
Rot. Bonds3

About 2-(3-propan-2-yl-1,2-thiazol-5-yl)propanoic acid

2-(3-propan-2-yl-1,2-thiazol-5-yl)propanoic acid (PubChem CID 82397722) has the molecular formula C9H13NO2S and a molecular weight of 199.27 g/mol. Its IUPAC name is 2-(3-propan-2-yl-1,2-thiazol-5-yl)propanoic acid.

Molecular Properties

Compound Name2-(3-propan-2-yl-1,2-thiazol-5-yl)propanoic acid
PubChem CID82397722
Molecular FormulaC9H13NO2S
Molecular Weight199.27 g/mol
Exact Mass199.07
IUPAC Name2-(3-propan-2-yl-1,2-thiazol-5-yl)propanoic acid
SMILESCC(C)c1cc(C(C)C(=O)O)sn1
InChIInChI=1S/C9H13NO2S/c1-5(2)7-4-8(13-10-7)6(3)9(11)12/h4-6H,1-3H3,(H,11,12)
InChIKeyQQKIIEKUOUZJCD-UHFFFAOYSA-N
XLogP2.45
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500199.27
LogP ≤ 52.45
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(3-propan-2-yl-1,2-thiazol-5-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-(3-Methyl-1,2-thiazol-5-yl)acetic acid
CID 82372986
2,2-Difluoro-2-(3-methyl-1,2-thiazol-5-yl)acetic acid
CID 130882635
2-Fluoro-2-(3-methyl-1,2-thiazol-5-yl)acetic acid
CID 131121519
5-Methyl-3-isothiazoleacetic acid
CID 14791280
3-Methyl-2-(3-methyl-1,2-thiazol-5-yl)butanoic acid
CID 126985703
3-Methyl-2-(3-methyl-1,2-thiazol-5-yl)butanoic acid;2-methylpropane;2-(3-methyl-1,2-thiazol-5-yl)acetic acid
CID 162032109
2-Iodopropane;3-methyl-2-(3-methyl-1,2-thiazol-5-yl)butanoic acid;2-(3-methyl-1,2-thiazol-5-yl)acetic acid
CID 163575361
3-(2-Methylpropyl)-1,2-thiazole-5-carboxylic acid
CID 82372955
2-(3-Tert-butyl-1,2-thiazol-5-yl)acetic acid
CID 82372987
2-(3-Ethyl-1,2-thiazol-5-yl)acetic acid
CID 82372988
2-(3-Propan-2-yl-1,2-thiazol-5-yl)acetic acid
CID 82372989
2-[3-(2-Methylpropyl)-1,2-thiazol-5-yl]acetic acid
CID 82372990

Frequently Asked Questions

What is the IUPAC name of 2-(3-propan-2-yl-1,2-thiazol-5-yl)propanoic acid?
The IUPAC name of 2-(3-propan-2-yl-1,2-thiazol-5-yl)propanoic acid (CID 82397722) is 2-(3-propan-2-yl-1,2-thiazol-5-yl)propanoic acid.
What is the SMILES notation for 2-(3-propan-2-yl-1,2-thiazol-5-yl)propanoic acid?
The canonical SMILES for 2-(3-propan-2-yl-1,2-thiazol-5-yl)propanoic acid is CC(C)c1cc(C(C)C(=O)O)sn1.
What is the InChIKey of 2-(3-propan-2-yl-1,2-thiazol-5-yl)propanoic acid?
The InChIKey is QQKIIEKUOUZJCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO2S/c1-5(2)7-4-8(13-10-7)6(3)9(11)12/h4-6H,1-3H3,(H,11,12).
What are the key properties of 2-(3-propan-2-yl-1,2-thiazol-5-yl)propanoic acid?
2-(3-propan-2-yl-1,2-thiazol-5-yl)propanoic acid has a molecular weight of 199.27 g/mol, XLogP of 2.45, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-propan-2-yl-1,2-thiazol-5-yl)propanoic acid is sourced from PubChem (CID 82397722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).