C20H25FN3O14P3-2 — CID 163575976
[[(2R,3R,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-oxidophosphoryl] [methyl-[[(2S)-1-oxo-1-phenylmethoxypropan-2-yl]amino]phosphoryl] phosphate (PubChem CID 163575976) has the molecular formula C20H25FN3O14P3-2 and a molecular weight of 643.35 g/mol. Its IUPAC name is [[(2R,3R,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-oxidophosphoryl] [methyl-[[(2S)-1-oxo-1-phenylmethoxypropan-2-yl]amino]phosphoryl] phosphate.
| Compound Name | [[(2R,3R,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-oxidophosphoryl] [methyl-[[(2S)-1-oxo-1-phenylmethoxypropan-2-yl]amino]phosphoryl] phosphate |
|---|---|
| PubChem CID | 163575976 |
| Molecular Formula | C20H25FN3O14P3-2 |
| Molecular Weight | 643.35 g/mol |
| Exact Mass | 643.05 |
| IUPAC Name | [[(2R,3R,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-oxidophosphoryl] [methyl-[[(2S)-1-oxo-1-phenylmethoxypropan-2-yl]amino]phosphoryl] phosphate |
| SMILES | C[C@H](NP(C)(=O)OP(=O)([O-])OP(=O)([O-])OC[C@H]1O[C@@H](n2cc(F)c(=O)[nH]c2=O)C[C@H]1O)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H27FN3O14P3/c1-12(19(27)34-10-13-6-4-3-5-7-13)23-39(2,29)37-41(32,33)38-40(30,31)35-11-16-15(25)8-17(36-16)24-9-14(21)18(26)22-20(24)28/h3-7,9,12,15-17,25H,8,10-11H2,1-2H3,(H,23,29)(H,30,31)(H,32,33)(H,22,26,28)/p-2/t12-,15+,16+,17+,39?/m0/s1 |
| InChIKey | GDMLQUPAVHTYSW-FSADDWFKSA-L |
| XLogP | -0.14 |
| TPSA | 247.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.35 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|