C12H21NO — CID 163578465
4,6,6-trimethylcyclooctene-1-carboxamide (PubChem CID 163578465) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is 4,6,6-trimethylcyclooctene-1-carboxamide.
| Compound Name | 4,6,6-trimethylcyclooctene-1-carboxamide |
|---|---|
| PubChem CID | 163578465 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | 4,6,6-trimethylcyclooctene-1-carboxamide |
| SMILES | CC1CC=C(C(N)=O)CCC(C)(C)C1 |
| InChI | InChI=1S/C12H21NO/c1-9-4-5-10(11(13)14)6-7-12(2,3)8-9/h5,9H,4,6-8H2,1-3H3,(H2,13,14) |
| InChIKey | GFOAKCZBKGFTGR-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |