C9H13NO — CID 144921017
4-methylcyclohepta-1,6-diene-1-carboxamide (PubChem CID 144921017) has the molecular formula C9H13NO and a molecular weight of 151.21 g/mol. Its IUPAC name is 4-methylcyclohepta-1,6-diene-1-carboxamide.
| Compound Name | 4-methylcyclohepta-1,6-diene-1-carboxamide |
|---|---|
| PubChem CID | 144921017 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | 4-methylcyclohepta-1,6-diene-1-carboxamide |
| SMILES | CC1CC=CC(C(N)=O)=CC1 |
| InChI | InChI=1S/C9H13NO/c1-7-3-2-4-8(6-5-7)9(10)11/h2,4,6-7H,3,5H2,1H3,(H2,10,11) |
| InChIKey | CZZHPCANZPXWRV-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |