C10H14N2O — CID 143183825
(3E,5Z,8Z)-7-methyl-2,7-dihydro-1H-azonine-4-carboxamide (PubChem CID 143183825) has the molecular formula C10H14N2O and a molecular weight of 178.24 g/mol. Its IUPAC name is (3E,5Z,8Z)-7-methyl-2,7-dihydro-1H-azonine-4-carboxamide.
| Compound Name | (3E,5Z,8Z)-7-methyl-2,7-dihydro-1H-azonine-4-carboxamide |
|---|---|
| PubChem CID | 143183825 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | (3E,5Z,8Z)-7-methyl-2,7-dihydro-1H-azonine-4-carboxamide |
| SMILES | CC1/C=C\NC/C=C(C(N)=O)\C=C/1 |
| InChI | InChI=1S/C10H14N2O/c1-8-2-3-9(10(11)13)5-7-12-6-4-8/h2-6,8,12H,7H2,1H3,(H2,11,13)/b3-2-,6-4-,9-5+ |
| InChIKey | IYLAJXQFKKNMRZ-SAKHIMIFSA-N |
| XLogP | 0.71 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |