C21H34F2N2O2 — CID 163579055
tert-butyl N-[1-[(3E,4Z)-3-ethylidene-2,2-difluoro-7-methylocta-4,7-dienyl]piperidin-4-yl]carbamate (PubChem CID 163579055) has the molecular formula C21H34F2N2O2 and a molecular weight of 384.51 g/mol. Its IUPAC name is tert-butyl N-[1-[(3E,4Z)-3-ethylidene-2,2-difluoro-7-methylocta-4,7-dienyl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[(3E,4Z)-3-ethylidene-2,2-difluoro-7-methylocta-4,7-dienyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 163579055 |
| Molecular Formula | C21H34F2N2O2 |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.26 |
| IUPAC Name | tert-butyl N-[1-[(3E,4Z)-3-ethylidene-2,2-difluoro-7-methylocta-4,7-dienyl]piperidin-4-yl]carbamate |
| SMILES | C=C(C)C/C=C\C(=C/C)C(F)(F)CN1CCC(NC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C21H34F2N2O2/c1-7-17(10-8-9-16(2)3)21(22,23)15-25-13-11-18(12-14-25)24-19(26)27-20(4,5)6/h7-8,10,18H,2,9,11-15H2,1,3-6H3,(H,24,26)/b10-8-,17-7+ |
| InChIKey | GFZIKYHUZREVCY-JPDYVDGYSA-N |
| XLogP | 5.08 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|