About CID 163579114
CID 163579114 (PubChem CID 163579114) has the molecular formula C4H7INO-
and a molecular weight of 212.01 g/mol.
Molecular Properties
| Compound Name | CID 163579114 |
| PubChem CID | 163579114 |
| Molecular Formula | C4H7INO- |
| Molecular Weight | 212.01 g/mol |
| Exact Mass | 211.96 |
| IUPAC Name | — |
| SMILES | NC(=O)CC1C[I-]1 |
| InChI | InChI=1S/C4H7INO/c6-4(7)1-3-2-5-3/h3H,1-2H2,(H2,6,7)/q-1 |
| InChIKey | LETVAGQWEUGBAN-UHFFFAOYSA-N |
| XLogP | -3.67 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.01 |
| LogP ≤ 5 | -3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze CID 163579114 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 163579114?
The IUPAC name of CID 163579114 (CID 163579114) is not available.
What is the SMILES notation for CID 163579114?
The canonical SMILES for CID 163579114 is NC(=O)CC1C[I-]1.
What is the InChIKey of CID 163579114?
The InChIKey is LETVAGQWEUGBAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7INO/c6-4(7)1-3-2-5-3/h3H,1-2H2,(H2,6,7)/q-1.
What are the key properties of CID 163579114?
CID 163579114 has a molecular weight of 212.01 g/mol, XLogP of -3.67, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 163579114 is sourced from PubChem (CID 163579114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).