C19H22BBrO3 — CID 163580215
2-[(3Z)-4-(5-bromo-3-methyl-1-benzofuran-2-yl)buta-1,3-dien-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 163580215) has the molecular formula C19H22BBrO3 and a molecular weight of 389.10 g/mol. Its IUPAC name is 2-[(3Z)-4-(5-bromo-3-methyl-1-benzofuran-2-yl)buta-1,3-dien-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[(3Z)-4-(5-bromo-3-methyl-1-benzofuran-2-yl)buta-1,3-dien-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 163580215 |
| Molecular Formula | C19H22BBrO3 |
| Molecular Weight | 389.10 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | 2-[(3Z)-4-(5-bromo-3-methyl-1-benzofuran-2-yl)buta-1,3-dien-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | C=C(/C=C\c1oc2ccc(Br)cc2c1C)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C19H22BBrO3/c1-12(20-23-18(3,4)19(5,6)24-20)7-9-16-13(2)15-11-14(21)8-10-17(15)22-16/h7-11H,1H2,2-6H3/b9-7- |
| InChIKey | GGXLAAHXBHASJX-CLFYSBASSA-N |
| XLogP | 5.70 |
| TPSA | 31.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.10 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|