C24H24N2 — CID 163583859
N-(4-methanimidoylphenyl)-4-methyl-N-[4-(2-methylcyclopropyl)phenyl]aniline (PubChem CID 163583859) has the molecular formula C24H24N2 and a molecular weight of 340.47 g/mol. Its IUPAC name is N-(4-methanimidoylphenyl)-4-methyl-N-[4-(2-methylcyclopropyl)phenyl]aniline.
| Compound Name | N-(4-methanimidoylphenyl)-4-methyl-N-[4-(2-methylcyclopropyl)phenyl]aniline |
|---|---|
| PubChem CID | 163583859 |
| Molecular Formula | C24H24N2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | N-(4-methanimidoylphenyl)-4-methyl-N-[4-(2-methylcyclopropyl)phenyl]aniline |
| SMILES | [H]/N=C/c1ccc(N(c2ccc(C)cc2)c2ccc(C3CC3C)cc2)cc1 |
| InChI | InChI=1S/C24H24N2/c1-17-3-9-21(10-4-17)26(22-11-5-19(16-25)6-12-22)23-13-7-20(8-14-23)24-15-18(24)2/h3-14,16,18,24-25H,15H2,1-2H3/b25-16+ |
| InChIKey | XZQRDNJIYYFOQQ-PCLIKHOPSA-N |
| XLogP | 6.59 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|