C6H16N2O5 — CID 163584833
N'-methylperoxy-N-propan-2-yloxyethane-1,2-diamine oxide (PubChem CID 163584833) has the molecular formula C6H16N2O5 and a molecular weight of 196.20 g/mol. Its IUPAC name is N'-methylperoxy-N-propan-2-yloxyethane-1,2-diamine oxide.
| Compound Name | N'-methylperoxy-N-propan-2-yloxyethane-1,2-diamine oxide |
|---|---|
| PubChem CID | 163584833 |
| Molecular Formula | C6H16N2O5 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | N'-methylperoxy-N-propan-2-yloxyethane-1,2-diamine oxide |
| SMILES | COO[NH+]([O-])CC[NH+]([O-])OC(C)C |
| InChI | InChI=1S/C6H16N2O5/c1-6(2)12-7(9)4-5-8(10)13-11-3/h6-8H,4-5H2,1-3H3 |
| InChIKey | GKPNANGIQBWZKU-UHFFFAOYSA-N |
| XLogP | -2.42 |
| TPSA | 82.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | -2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|