C2H4I2N2S — CID 163590093
methyl N,N'-diiodocarbamimidothioate (PubChem CID 163590093) has the molecular formula C2H4I2N2S and a molecular weight of 341.94 g/mol. Its IUPAC name is methyl N,N'-diiodocarbamimidothioate.
| Compound Name | methyl N,N'-diiodocarbamimidothioate |
|---|---|
| PubChem CID | 163590093 |
| Molecular Formula | C2H4I2N2S |
| Molecular Weight | 341.94 g/mol |
| Exact Mass | 341.82 |
| IUPAC Name | methyl N,N'-diiodocarbamimidothioate |
| SMILES | CSC(=NI)NI |
| InChI | InChI=1S/C2H4I2N2S/c1-7-2(5-3)6-4/h1H3,(H,5,6) |
| InChIKey | GOUFPOGQUAOPET-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.94 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|