C22H23NO6 — CID 163597878
(2S)-2-(4,9-dihydro-3H-fluoren-9-ylmethoxycarbonylamino)-4-oxo-4-prop-2-enoxybutanoic acid (PubChem CID 163597878) has the molecular formula C22H23NO6 and a molecular weight of 397.43 g/mol. Its IUPAC name is (2S)-2-(4,9-dihydro-3H-fluoren-9-ylmethoxycarbonylamino)-4-oxo-4-prop-2-enoxybutanoic acid.
| Compound Name | (2S)-2-(4,9-dihydro-3H-fluoren-9-ylmethoxycarbonylamino)-4-oxo-4-prop-2-enoxybutanoic acid |
|---|---|
| PubChem CID | 163597878 |
| Molecular Formula | C22H23NO6 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | (2S)-2-(4,9-dihydro-3H-fluoren-9-ylmethoxycarbonylamino)-4-oxo-4-prop-2-enoxybutanoic acid |
| SMILES | C=CCOC(=O)C[C@H](NC(=O)OCC1C2=C(CCC=C2)c2ccccc21)C(=O)O |
| InChI | InChI=1S/C22H23NO6/c1-2-11-28-20(24)12-19(21(25)26)23-22(27)29-13-18-16-9-5-3-7-14(16)15-8-4-6-10-17(15)18/h2-3,5-7,9-10,18-19H,1,4,8,11-13H2,(H,23,27)(H,25,26)/t18?,19-/m0/s1 |
| InChIKey | GVBCVQVUDUDDHE-GGYWPGCISA-N |
| XLogP | 3.19 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|