C27H28N2O7 — CID 175979478
4-O-prop-2-enyl 1-O-(pyrrolidine-2-carbonyl) (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanedioate (PubChem CID 175979478) has the molecular formula C27H28N2O7 and a molecular weight of 492.53 g/mol. Its IUPAC name is 4-O-prop-2-enyl 1-O-(pyrrolidine-2-carbonyl) (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanedioate.
| Compound Name | 4-O-prop-2-enyl 1-O-(pyrrolidine-2-carbonyl) (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanedioate |
|---|---|
| PubChem CID | 175979478 |
| Molecular Formula | C27H28N2O7 |
| Molecular Weight | 492.53 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | 4-O-prop-2-enyl 1-O-(pyrrolidine-2-carbonyl) (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanedioate |
| SMILES | C=CCOC(=O)C[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)OC(=O)C1CCCN1 |
| InChI | InChI=1S/C27H28N2O7/c1-2-14-34-24(30)15-23(26(32)36-25(31)22-12-7-13-28-22)29-27(33)35-16-21-19-10-5-3-8-17(19)18-9-4-6-11-20(18)21/h2-6,8-11,21-23,28H,1,7,12-16H2,(H,29,33)/t22?,23-/m0/s1 |
| InChIKey | DWYDAHVPKSPPAY-WCSIJFPASA-N |
| XLogP | 2.83 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.53 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|