C35H28O10 — CID 163600716
[(1R,4S)-1,4,5-tribenzoyloxy-7-hydroxy-3-oxabicyclo[4.1.0]heptan-2-yl]methyl benzoate (PubChem CID 163600716) has the molecular formula C35H28O10 and a molecular weight of 608.60 g/mol. Its IUPAC name is [(1R,4S)-1,4,5-tribenzoyloxy-7-hydroxy-3-oxabicyclo[4.1.0]heptan-2-yl]methyl benzoate.
| Compound Name | [(1R,4S)-1,4,5-tribenzoyloxy-7-hydroxy-3-oxabicyclo[4.1.0]heptan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 163600716 |
| Molecular Formula | C35H28O10 |
| Molecular Weight | 608.60 g/mol |
| Exact Mass | 608.17 |
| IUPAC Name | [(1R,4S)-1,4,5-tribenzoyloxy-7-hydroxy-3-oxabicyclo[4.1.0]heptan-2-yl]methyl benzoate |
| SMILES | O=C(OCC1O[C@@H](OC(=O)c2ccccc2)C(OC(=O)c2ccccc2)C2C(O)[C@@]12OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H28O10/c36-29-27-28(43-31(38)23-15-7-2-8-16-23)34(44-32(39)24-17-9-3-10-18-24)42-26(21-41-30(37)22-13-5-1-6-14-22)35(27,29)45-33(40)25-19-11-4-12-20-25/h1-20,26-29,34,36H,21H2/t26?,27?,28?,29?,34-,35+/m0/s1 |
| InChIKey | GXJRMGHNNGQEKX-SYTXRNMSSA-N |
| XLogP | 4.24 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.60 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|