C45H37N3OSi — CID 163602527
N-(1-methylcyclohexa-2,4-dien-1-yl)-N-phenyl-4-[5-(4-triphenylsilylphenyl)-1,3,4-oxadiazol-2-yl]aniline (PubChem CID 163602527) has the molecular formula C45H37N3OSi and a molecular weight of 663.90 g/mol. Its IUPAC name is N-(1-methylcyclohexa-2,4-dien-1-yl)-N-phenyl-4-[5-(4-triphenylsilylphenyl)-1,3,4-oxadiazol-2-yl]aniline.
| Compound Name | N-(1-methylcyclohexa-2,4-dien-1-yl)-N-phenyl-4-[5-(4-triphenylsilylphenyl)-1,3,4-oxadiazol-2-yl]aniline |
|---|---|
| PubChem CID | 163602527 |
| Molecular Formula | C45H37N3OSi |
| Molecular Weight | 663.90 g/mol |
| Exact Mass | 663.27 |
| IUPAC Name | N-(1-methylcyclohexa-2,4-dien-1-yl)-N-phenyl-4-[5-(4-triphenylsilylphenyl)-1,3,4-oxadiazol-2-yl]aniline |
| SMILES | CC1(N(c2ccccc2)c2ccc(-c3nnc(-c4ccc([Si](c5ccccc5)(c5ccccc5)c5ccccc5)cc4)o3)cc2)C=CC=CC1 |
| InChI | InChI=1S/C45H37N3OSi/c1-45(33-15-6-16-34-45)48(37-17-7-2-8-18-37)38-29-25-35(26-30-38)43-46-47-44(49-43)36-27-31-42(32-28-36)50(39-19-9-3-10-20-39,40-21-11-4-12-22-40)41-23-13-5-14-24-41/h2-33H,34H2,1H3 |
| InChIKey | GYWKEVFPIOMVPZ-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 42.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.90 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|