C12H17INO4S- — CID 163605308
(2,5-dioxopyrrolidin-1-yl) 4-[(2S)-thiolan-2-yl]iodanuidylbutanoate (PubChem CID 163605308) has the molecular formula C12H17INO4S- and a molecular weight of 398.24 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 4-[(2S)-thiolan-2-yl]iodanuidylbutanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 4-[(2S)-thiolan-2-yl]iodanuidylbutanoate |
|---|---|
| PubChem CID | 163605308 |
| Molecular Formula | C12H17INO4S- |
| Molecular Weight | 398.24 g/mol |
| Exact Mass | 397.99 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-[(2S)-thiolan-2-yl]iodanuidylbutanoate |
| SMILES | O=C(CCC[I-][C@H]1CCCS1)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C12H17INO4S/c15-10-5-6-11(16)14(10)18-12(17)4-1-7-13-9-3-2-8-19-9/h9H,1-8H2/q-1/t9-/m1/s1 |
| InChIKey | YUMXGEQVDQGCGX-SECBINFHSA-N |
| XLogP | -1.68 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.24 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|