C24H24N2O4 — CID 163605343
2-(pyridine-3-carbonylamino)ethyl 2-[3-(cyclohexa-1,3-diene-1-carbonyl)phenyl]propanoate (PubChem CID 163605343) has the molecular formula C24H24N2O4 and a molecular weight of 404.47 g/mol. Its IUPAC name is 2-(pyridine-3-carbonylamino)ethyl 2-[3-(cyclohexa-1,3-diene-1-carbonyl)phenyl]propanoate.
| Compound Name | 2-(pyridine-3-carbonylamino)ethyl 2-[3-(cyclohexa-1,3-diene-1-carbonyl)phenyl]propanoate |
|---|---|
| PubChem CID | 163605343 |
| Molecular Formula | C24H24N2O4 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 2-(pyridine-3-carbonylamino)ethyl 2-[3-(cyclohexa-1,3-diene-1-carbonyl)phenyl]propanoate |
| SMILES | CC(C(=O)OCCNC(=O)c1cccnc1)c1cccc(C(=O)C2=CC=CCC2)c1 |
| InChI | InChI=1S/C24H24N2O4/c1-17(24(29)30-14-13-26-23(28)21-11-6-12-25-16-21)19-9-5-10-20(15-19)22(27)18-7-3-2-4-8-18/h2-3,5-7,9-12,15-17H,4,8,13-14H2,1H3,(H,26,28) |
| InChIKey | HBHCMEYOXKZIDN-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|