C35H31N3O7 — CID 163605829
[10-(2-methylphenyl)-6-[(4-nitrophenyl)methoxycarbonylamino]-3-oxa-17-azapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(21),2(11),4(9),5,7,12-hexaen-10-yl] formate (PubChem CID 163605829) has the molecular formula C35H31N3O7 and a molecular weight of 605.65 g/mol. Its IUPAC name is [10-(2-methylphenyl)-6-[(4-nitrophenyl)methoxycarbonylamino]-3-oxa-17-azapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(21),2(11),4(9),5,7,12-hexaen-10-yl] formate.
| Compound Name | [10-(2-methylphenyl)-6-[(4-nitrophenyl)methoxycarbonylamino]-3-oxa-17-azapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(21),2(11),4(9),5,7,12-hexaen-10-yl] formate |
|---|---|
| PubChem CID | 163605829 |
| Molecular Formula | C35H31N3O7 |
| Molecular Weight | 605.65 g/mol |
| Exact Mass | 605.22 |
| IUPAC Name | [10-(2-methylphenyl)-6-[(4-nitrophenyl)methoxycarbonylamino]-3-oxa-17-azapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(21),2(11),4(9),5,7,12-hexaen-10-yl] formate |
| SMILES | Cc1ccccc1C1(OC=O)c2ccc(NC(=O)OCc3ccc([N+](=O)[O-])cc3)cc2Oc2c1cc1c3c2CCCN3CCC1 |
| InChI | InChI=1S/C35H31N3O7/c1-22-6-2-3-9-28(22)35(44-21-39)29-15-12-25(36-34(40)43-20-23-10-13-26(14-11-23)38(41)42)19-31(29)45-33-27-8-5-17-37-16-4-7-24(32(27)37)18-30(33)35/h2-3,6,9-15,18-19,21H,4-5,7-8,16-17,20H2,1H3,(H,36,40) |
| InChIKey | HBRMROBFOOSCHL-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 120.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.65 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|