C16H32O5 — CID 163610250
(2S,5R)-2-tert-butyl-3-(2-hydroxypropoxy)-5-[(2-methylpropan-2-yl)oxy]oxan-4-ol (PubChem CID 163610250) has the molecular formula C16H32O5 and a molecular weight of 304.43 g/mol. Its IUPAC name is (2S,5R)-2-tert-butyl-3-(2-hydroxypropoxy)-5-[(2-methylpropan-2-yl)oxy]oxan-4-ol.
| Compound Name | (2S,5R)-2-tert-butyl-3-(2-hydroxypropoxy)-5-[(2-methylpropan-2-yl)oxy]oxan-4-ol |
|---|---|
| PubChem CID | 163610250 |
| Molecular Formula | C16H32O5 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | (2S,5R)-2-tert-butyl-3-(2-hydroxypropoxy)-5-[(2-methylpropan-2-yl)oxy]oxan-4-ol |
| SMILES | CC(O)COC1C(O)[C@H](OC(C)(C)C)CO[C@H]1C(C)(C)C |
| InChI | InChI=1S/C16H32O5/c1-10(17)8-19-13-12(18)11(21-16(5,6)7)9-20-14(13)15(2,3)4/h10-14,17-18H,8-9H2,1-7H3/t10?,11-,12?,13?,14-/m1/s1 |
| InChIKey | HFGXVPAEDSWVBX-YZYFRFPQSA-N |
| XLogP | 1.74 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |