C13H24O4 — CID 139315328
(3R,3aR,6S,6aR)-6-[(2-methylpropan-2-yl)oxy]-3-propan-2-yloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan (PubChem CID 139315328) has the molecular formula C13H24O4 and a molecular weight of 244.33 g/mol. Its IUPAC name is (3R,3aR,6S,6aR)-6-[(2-methylpropan-2-yl)oxy]-3-propan-2-yloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan.
| Compound Name | (3R,3aR,6S,6aR)-6-[(2-methylpropan-2-yl)oxy]-3-propan-2-yloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan |
|---|---|
| PubChem CID | 139315328 |
| Molecular Formula | C13H24O4 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | (3R,3aR,6S,6aR)-6-[(2-methylpropan-2-yl)oxy]-3-propan-2-yloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan |
| SMILES | CC(C)O[C@@H]1CO[C@H]2[C@@H]1OC[C@@H]2OC(C)(C)C |
| InChI | InChI=1S/C13H24O4/c1-8(2)16-9-6-14-12-10(7-15-11(9)12)17-13(3,4)5/h8-12H,6-7H2,1-5H3/t9-,10+,11-,12-/m1/s1 |
| InChIKey | YVWPPJZXIJTXMF-WRWGMCAJSA-N |
| XLogP | 1.76 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |