C16H28O5 — CID 158127104
1-[[(3aR,6aR)-6-(2-methylbutan-2-yloxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-3-methylbutan-2-one (PubChem CID 158127104) has the molecular formula C16H28O5 and a molecular weight of 300.39 g/mol. Its IUPAC name is 1-[[(3aR,6aR)-6-(2-methylbutan-2-yloxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-3-methylbutan-2-one.
| Compound Name | 1-[[(3aR,6aR)-6-(2-methylbutan-2-yloxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-3-methylbutan-2-one |
|---|---|
| PubChem CID | 158127104 |
| Molecular Formula | C16H28O5 |
| Molecular Weight | 300.39 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | 1-[[(3aR,6aR)-6-(2-methylbutan-2-yloxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-3-methylbutan-2-one |
| SMILES | CCC(C)(C)OC1CO[C@@H]2C(OCC(=O)C(C)C)CO[C@H]12 |
| InChI | InChI=1S/C16H28O5/c1-6-16(4,5)21-13-9-20-14-12(8-19-15(13)14)18-7-11(17)10(2)3/h10,12-15H,6-9H2,1-5H3/t12?,13?,14-,15-/m1/s1 |
| InChIKey | FSHXOFLBEFQIIL-NEXFUWMNSA-N |
| XLogP | 1.97 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.39 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |