C16H30O3 — CID 139523209
(3S,3aR,6R,6aS)-3-(2-methylhexyl)-6-propan-2-yloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan (PubChem CID 139523209) has the molecular formula C16H30O3 and a molecular weight of 270.41 g/mol. Its IUPAC name is (3S,3aR,6R,6aS)-3-(2-methylhexyl)-6-propan-2-yloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan.
| Compound Name | (3S,3aR,6R,6aS)-3-(2-methylhexyl)-6-propan-2-yloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan |
|---|---|
| PubChem CID | 139523209 |
| Molecular Formula | C16H30O3 |
| Molecular Weight | 270.41 g/mol |
| Exact Mass | 270.22 |
| IUPAC Name | (3S,3aR,6R,6aS)-3-(2-methylhexyl)-6-propan-2-yloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan |
| SMILES | CCCCC(C)C[C@H]1CO[C@H]2[C@@H]1OC[C@H]2OC(C)C |
| InChI | InChI=1S/C16H30O3/c1-5-6-7-12(4)8-13-9-17-16-14(19-11(2)3)10-18-15(13)16/h11-16H,5-10H2,1-4H3/t12?,13-,14+,15+,16+/m0/s1 |
| InChIKey | ITHBUCDHAPQWCC-GJFSAVBPSA-N |
| XLogP | 3.41 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.41 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |