C23H28N6O3S — CID 163613502
3-[1-[4-(1-methylsulfonylpiperidin-4-yl)oxyquinazolin-2-yl]ethylimino]-3-(1H-pyrrol-2-yl)prop-1-en-1-amine (PubChem CID 163613502) has the molecular formula C23H28N6O3S and a molecular weight of 468.58 g/mol. Its IUPAC name is 3-[1-[4-(1-methylsulfonylpiperidin-4-yl)oxyquinazolin-2-yl]ethylimino]-3-(1H-pyrrol-2-yl)prop-1-en-1-amine.
| Compound Name | 3-[1-[4-(1-methylsulfonylpiperidin-4-yl)oxyquinazolin-2-yl]ethylimino]-3-(1H-pyrrol-2-yl)prop-1-en-1-amine |
|---|---|
| PubChem CID | 163613502 |
| Molecular Formula | C23H28N6O3S |
| Molecular Weight | 468.58 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | 3-[1-[4-(1-methylsulfonylpiperidin-4-yl)oxyquinazolin-2-yl]ethylimino]-3-(1H-pyrrol-2-yl)prop-1-en-1-amine |
| SMILES | CC(/N=C(\C=CN)c1ccc[nH]1)c1nc(OC2CCN(S(C)(=O)=O)CC2)c2ccccc2n1 |
| InChI | InChI=1S/C23H28N6O3S/c1-16(26-21(9-12-24)20-8-5-13-25-20)22-27-19-7-4-3-6-18(19)23(28-22)32-17-10-14-29(15-11-17)33(2,30)31/h3-9,12-13,16-17,25H,10-11,14-15,24H2,1-2H3/b12-9?,26-21+ |
| InChIKey | MPVBFGFTTZXPRO-UCNMUTAESA-N |
| XLogP | 2.78 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.58 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|