C21H24N6O2 — CID 163615587
4-(2H-chromen-6-ylamino)-2-[[2-(methylamino)cyclohexylidene]amino]pyrimidine-5-carboxamide (PubChem CID 163615587) has the molecular formula C21H24N6O2 and a molecular weight of 392.46 g/mol. Its IUPAC name is 4-(2H-chromen-6-ylamino)-2-[[2-(methylamino)cyclohexylidene]amino]pyrimidine-5-carboxamide.
| Compound Name | 4-(2H-chromen-6-ylamino)-2-[[2-(methylamino)cyclohexylidene]amino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 163615587 |
| Molecular Formula | C21H24N6O2 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | 4-(2H-chromen-6-ylamino)-2-[[2-(methylamino)cyclohexylidene]amino]pyrimidine-5-carboxamide |
| SMILES | CNC1CCCCC1=Nc1ncc(C(N)=O)c(Nc2ccc3c(c2)C=CCO3)n1 |
| InChI | InChI=1S/C21H24N6O2/c1-23-16-6-2-3-7-17(16)26-21-24-12-15(19(22)28)20(27-21)25-14-8-9-18-13(11-14)5-4-10-29-18/h4-5,8-9,11-12,16,23H,2-3,6-7,10H2,1H3,(H2,22,28)(H,24,25,27) |
| InChIKey | HJSJZMRFWFNFHV-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 114.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|