C9H16O4S — CID 163616011
methoxy-[(2S,3R,4S)-4-methoxy-2-methyloxan-3-yl]oxymethanethione (PubChem CID 163616011) has the molecular formula C9H16O4S and a molecular weight of 220.29 g/mol. Its IUPAC name is methoxy-[(2S,3R,4S)-4-methoxy-2-methyloxan-3-yl]oxymethanethione.
| Compound Name | methoxy-[(2S,3R,4S)-4-methoxy-2-methyloxan-3-yl]oxymethanethione |
|---|---|
| PubChem CID | 163616011 |
| Molecular Formula | C9H16O4S |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | methoxy-[(2S,3R,4S)-4-methoxy-2-methyloxan-3-yl]oxymethanethione |
| SMILES | COC(=S)O[C@@H]1[C@H](C)OCC[C@@H]1OC |
| InChI | InChI=1S/C9H16O4S/c1-6-8(13-9(14)11-3)7(10-2)4-5-12-6/h6-8H,4-5H2,1-3H3/t6-,7-,8+/m0/s1 |
| InChIKey | HKBXVMVLNIEIJB-BIIVOSGPSA-N |
| XLogP | 1.13 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|