C5H9IO2 — CID 162786702
(2R,3S)-2-iodo-3-methoxyoxolane (PubChem CID 162786702) has the molecular formula C5H9IO2 and a molecular weight of 228.03 g/mol. Its IUPAC name is (2R,3S)-2-iodo-3-methoxyoxolane.
| Compound Name | (2R,3S)-2-iodo-3-methoxyoxolane |
|---|---|
| PubChem CID | 162786702 |
| Molecular Formula | C5H9IO2 |
| Molecular Weight | 228.03 g/mol |
| Exact Mass | 227.96 |
| IUPAC Name | (2R,3S)-2-iodo-3-methoxyoxolane |
| SMILES | CO[C@H]1CCO[C@@H]1I |
| InChI | InChI=1S/C5H9IO2/c1-7-4-2-3-8-5(4)6/h4-5H,2-3H2,1H3/t4-,5-/m0/s1 |
| InChIKey | YJGWLPHQHIRXRW-WHFBIAKZSA-N |
| XLogP | 1.18 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.03 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|