About 2-bromo-4-methoxyoxane
2-bromo-4-methoxyoxane (PubChem CID 142459043) has the molecular formula C6H11BrO2
and a molecular weight of 195.06 g/mol. Its IUPAC name is 2-bromo-4-methoxyoxane.
Molecular Properties
| Compound Name | 2-bromo-4-methoxyoxane |
| PubChem CID | 142459043 |
| Molecular Formula | C6H11BrO2 |
| Molecular Weight | 195.06 g/mol |
| Exact Mass | 193.99 |
| IUPAC Name | 2-bromo-4-methoxyoxane |
| SMILES | COC1CCOC(Br)C1 |
| InChI | InChI=1S/C6H11BrO2/c1-8-5-2-3-9-6(7)4-5/h5-6H,2-4H2,1H3 |
| InChIKey | BEWKUJNGRDXHRI-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.06 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-4-methoxyoxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-4-methoxyoxane?
The IUPAC name of 2-bromo-4-methoxyoxane (CID 142459043) is 2-bromo-4-methoxyoxane.
What is the SMILES notation for 2-bromo-4-methoxyoxane?
The canonical SMILES for 2-bromo-4-methoxyoxane is COC1CCOC(Br)C1.
What is the InChIKey of 2-bromo-4-methoxyoxane?
The InChIKey is BEWKUJNGRDXHRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11BrO2/c1-8-5-2-3-9-6(7)4-5/h5-6H,2-4H2,1H3.
What are the key properties of 2-bromo-4-methoxyoxane?
2-bromo-4-methoxyoxane has a molecular weight of 195.06 g/mol, XLogP of 1.53, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-4-methoxyoxane is sourced from PubChem (CID 142459043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).