C17H24NO3+ — CID 163617109
9,10-dihydroxy-3-(2-methylpropyl)-3,4,5,6,7,11b-hexahydro-1H-benzo[a]quinolizin-5-ium-2-one (PubChem CID 163617109) has the molecular formula C17H24NO3+ and a molecular weight of 290.38 g/mol. Its IUPAC name is 9,10-dihydroxy-3-(2-methylpropyl)-3,4,5,6,7,11b-hexahydro-1H-benzo[a]quinolizin-5-ium-2-one.
| Compound Name | 9,10-dihydroxy-3-(2-methylpropyl)-3,4,5,6,7,11b-hexahydro-1H-benzo[a]quinolizin-5-ium-2-one |
|---|---|
| PubChem CID | 163617109 |
| Molecular Formula | C17H24NO3+ |
| Molecular Weight | 290.38 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | 9,10-dihydroxy-3-(2-methylpropyl)-3,4,5,6,7,11b-hexahydro-1H-benzo[a]quinolizin-5-ium-2-one |
| SMILES | CC(C)CC1C[NH+]2CCc3cc(O)c(O)cc3C2CC1=O |
| InChI | InChI=1S/C17H23NO3/c1-10(2)5-12-9-18-4-3-11-6-16(20)17(21)7-13(11)14(18)8-15(12)19/h6-7,10,12,14,20-21H,3-5,8-9H2,1-2H3/p+1 |
| InChIKey | HKXSWCIZVQFEQQ-UHFFFAOYSA-O |
| XLogP | 1.22 |
| TPSA | 61.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.38 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|