C44H56N4O8 — CID 163617311
tert-butyl 4-[2-oxo-1-(pent-4-enoyloxymethyl)quinolin-3-yl]piperidine-1-carboxylate;tert-butyl 4-(2-oxo-1H-quinolin-3-yl)piperidine-1-carboxylate (PubChem CID 163617311) has the molecular formula C44H56N4O8 and a molecular weight of 768.95 g/mol. Its IUPAC name is tert-butyl 4-[2-oxo-1-(pent-4-enoyloxymethyl)quinolin-3-yl]piperidine-1-carboxylate;tert-butyl 4-(2-oxo-1H-quinolin-3-yl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-oxo-1-(pent-4-enoyloxymethyl)quinolin-3-yl]piperidine-1-carboxylate;tert-butyl 4-(2-oxo-1H-quinolin-3-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 163617311 |
| Molecular Formula | C44H56N4O8 |
| Molecular Weight | 768.95 g/mol |
| Exact Mass | 768.41 |
| IUPAC Name | tert-butyl 4-[2-oxo-1-(pent-4-enoyloxymethyl)quinolin-3-yl]piperidine-1-carboxylate;tert-butyl 4-(2-oxo-1H-quinolin-3-yl)piperidine-1-carboxylate |
| SMILES | C=CCCC(=O)OCn1c(=O)c(C2CCN(C(=O)OC(C)(C)C)CC2)cc2ccccc21.CC(C)(C)OC(=O)N1CCC(c2cc3ccccc3[nH]c2=O)CC1 |
| InChI | InChI=1S/C25H32N2O5.C19H24N2O3/c1-5-6-11-22(28)31-17-27-21-10-8-7-9-19(21)16-20(23(27)29)18-12-14-26(15-13-18)24(30)32-25(2,3)4;1-19(2,3)24-18(23)21-10-8-13(9-11-21)15-12-14-6-4-5-7-16(14)20-17(15)22/h5,7-10,16,18H,1,6,11-15,17H2,2-4H3;4-7,12-13H,8-11H2,1-3H3,(H,20,22) |
| InChIKey | HLCBSGKMNGLTGA-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 140.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.95 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|